N-methyl-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide structure
|
Common Name | N-methyl-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 52943-15-4 | Molecular Weight | 234.29800 | |
| Density | 1.135g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C12H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | N-methyl-2-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.29800 |
| Flash Point | 208.3ºC |
| Exact Mass | 234.14800 |
| PSA | 51.96000 |
| LogP | 0.77070 |
| Index of Refraction | 1.557 |
| InChIKey | ULTOYBRJGTUCSN-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cccnc1N1CCN(C)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Methyl-2-(4-methyl-1-piperazinyl)-3-pyridinecarboxamide |
| 3-Pyridinecarboxamide,N-methyl-2-(4-methyl-1-piperazinyl) |
| N-METHYL-2-(4-METHYL-(PIPERAZIN-1-YL))NICOTINAMIDE |
| Nicotinamide,N-methyl-2-(4-methyl-1-piperazinyl) |