1-(2-methylphenoxy)-3-piperidin-1-ylpropan-2-ol,hydrochloride
Modify Date: 2025-11-27 20:33:39
1-(2-methylphenoxy)-3-piperidin-1-ylpropan-2-ol,hydrochloride structure
|
Common Name | 1-(2-methylphenoxy)-3-piperidin-1-ylpropan-2-ol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5296-28-6 | Molecular Weight | 285.81000 | |
| Density | 1.064g/cm3 | Boiling Point | 402.5ºC at 760 mmHg | |
| Molecular Formula | C15H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | 1-(2-methylphenoxy)-3-piperidin-1-ylpropan-2-ol,hydrochloride |
|---|
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 402.5ºC at 760 mmHg |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81000 |
| Flash Point | 197.2ºC |
| Exact Mass | 285.15000 |
| PSA | 32.70000 |
| LogP | 2.96050 |
| Index of Refraction | 1.537 |
| InChIKey | CHVLJEGOXABBFU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OCC(O)CN1CCCCC1.Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |