3-[(4-hydroxyphenyl)amino]propanesulphonic acid structure
|
Common Name | 3-[(4-hydroxyphenyl)amino]propanesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 52962-42-2 | Molecular Weight | 231.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-hydroxyanilino)propane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H13NO4S |
|---|---|
| Molecular Weight | 231.26900 |
| Exact Mass | 231.05700 |
| PSA | 95.01000 |
| LogP | 2.23580 |
| InChIKey | LIUOMZABQMKBFT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)CCCNc1ccc(O)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
3-[(4-hydroxyph... CAS#:52962-42-2 |
| Literature: Willems Bulletin des Societes Chimiques Belges, 1955 , vol. 64, p. 747,752, 768 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-((4-Hydroxyphenyl)amino)propanesulphonic acid |
| 3-[(4-hydroxyphenyl)amino]propanesulfonic acid |
| 3-(4-Hydroxy-anilino)-propan-1-sulfonsaeure |
| 3-[(4-hydroxyphenyl)amino]propane-1-sulfonic acid |
| EINECS 258-280-7 |
| 3-(4-hydroxy-anilino)-propane-1-sulfonic acid |
| 3-(4-Hydroxyphenylamino)propan-1-sulfonsaeure |
| 3-(4-hydroxyphenyl)amino-1-propanesulfonic acid |