ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate
Modify Date: 2025-09-18 15:43:12
![ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate Structure](https://image.chemsrc.com/caspic/303/52980-54-8.png)
ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate structure
|
Common Name | ethyl 2-[5-(5-nitro-2-furyl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 52980-54-8 | Molecular Weight | 283.19400 | |
| Density | 1.65g/cm3 | Boiling Point | 386.9ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | ethyl 2-[5-(5-nitrofuran-2-yl)-2-oxo-1,3,4-oxadiazol-3-yl]acetate |
|---|
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760 mmHg |
| Molecular Formula | C10H9N3O7 |
| Molecular Weight | 283.19400 |
| Flash Point | 187.8ºC |
| Exact Mass | 283.04400 |
| PSA | 133.29000 |
| LogP | 1.09080 |
| Index of Refraction | 1.645 |
| InChIKey | CPLLQPUCYJDKLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1nc(-c2ccc([N+](=O)[O-])o2)oc1=O |
|
~%
ethyl 2-[5-(5-n... CAS#:52980-54-8 |
| Literature: Akerblom Journal of Medicinal Chemistry, 1974 , vol. 17, # 7 p. 756 - 758 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |