Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside structure
|
Common Name | Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 53008-65-4 | Molecular Weight | 464.550 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 593.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C28H32O6 | Melting Point | 67ºC | |
| MSDS | N/A | Flash Point | 312.5±30.1 °C | |
| Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 593.0±50.0 °C at 760 mmHg |
| Melting Point | 67ºC |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.550 |
| Flash Point | 312.5±30.1 °C |
| Exact Mass | 464.219879 |
| PSA | 66.38000 |
| LogP | 6.94 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | MOKYEUQDXDKNDX-DFLSAPQXSA-N |
| SMILES | COC1OC(CO)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
|
Name: Inhibition of mushroom tyrosinase using L-tyrosine as substrate
Source: ChEMBL
Target: Polyphenol oxidase 4
External Id: CHEMBL4624352
|
|
Name: Inhibition of mushroom tyrosinase using L-DOPA as substrate
Source: ChEMBL
Target: Polyphenol oxidase 4
External Id: CHEMBL4624353
|
| Methyl2,3,4-tri-O-benzyl-a-D-glucopyranoside |
| Methyl 2,3,4-Tri-O-benzyl-Alpha-D-glucopyranoside |
| Methyl 2,3,4-tri-O-benzyl-α-D-glucopyranoside |