5-(Bromomethyl)-3-(3-nitrophenyl)-1,2-oxazole structure
|
Common Name | 5-(Bromomethyl)-3-(3-nitrophenyl)-1,2-oxazole | ||
|---|---|---|---|---|
| CAS Number | 5301-03-1 | Molecular Weight | 283.078 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 428.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.7±27.3 °C | |
| Name | 5-(bromomethyl)-3-(3-nitrophenyl)-1,2-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.1±40.0 °C at 760 mmHg |
| Molecular Formula | C10H7BrN2O3 |
| Molecular Weight | 283.078 |
| Flash Point | 212.7±27.3 °C |
| Exact Mass | 281.963989 |
| PSA | 71.85000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | XXBQYLWWZAASLO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(CBr)on2)c1 |
|
~%
5-(Bromomethyl)... CAS#:5301-03-1 |
| Literature: Sen; Seth; Joshi; Rajagopalan Journal of medicinal chemistry, 1966 , vol. 9, # 3 p. 431 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-bromomethyl-3-(3-nitrophenyl)isoxazole |
| Isoxazole, 5-(bromomethyl)-3-(3-nitrophenyl)- |
| 5-(Bromomethyl)-3-(3-nitrophenyl)-1,2-oxazole |