4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione
Modify Date: 2026-07-15 19:42:24
4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione structure
|
Common Name | 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 5301-89-3 | Molecular Weight | 283.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13N3O3 |
|---|---|
| Molecular Weight | 283.28 |
| InChIKey | FHRKAIANAMMKHL-UHFFFAOYSA-N |
| SMILES | O=c1n(CO)c(=O)n(-c2ccccc2)n1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: The English name of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione. |
| Q: What is the molecular weight of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: Molecular weight of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is 283.28. |
| Q: What is the CAS number of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: CAS number of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is 5301-89-3. |
| Q: What is the SMILES notation of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: SMILES notation of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is O=c1n(CO)c(=O)n(-c2ccccc2)n1-c1ccccc1. |
| Q: What is the Chinese name of 5301-89-3? |
| A: Chinese name of 5301-89-3 is 5301-89-3. |
| Q: What is the molecular formula of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: Molecular formula of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is C15H13N3O3. |
| Q: What is the InChIKey of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione? |
| A: InChIKey of 4-(Hydroxymethyl)-1,2-diphenyl-1,2,4-triazolidine-3,5-dione is FHRKAIANAMMKHL-UHFFFAOYSA-N. |