1-butyl-1,3,5-triazinane-2,4,6-trione structure
|
Common Name | 1-butyl-1,3,5-triazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 53015-84-2 | Molecular Weight | 185.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-butyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H11N3O3 |
|---|---|
| Molecular Weight | 185.18100 |
| Exact Mass | 185.08000 |
| PSA | 88.24000 |
| InChIKey | LQZVICGUEQCJCG-UHFFFAOYSA-N |
| SMILES | CCCCn1c(=O)[nH]c(=O)[nH]c1=O |
|
~%
1-butyl-1,3,5-t... CAS#:53015-84-2 |
| Literature: Close Journal of the American Chemical Society, 1953 , vol. 75, p. 3617,3618 |
|
~%
1-butyl-1,3,5-t... CAS#:53015-84-2 |
| Literature: Chiron-Charrier; Caubere Synthetic Communications, 1993 , vol. 23, # 19 p. 2659 - 2672 |
| N-butyl-1,3,5-triazine-2,4,6(1H,3H,5H)trione |
| N-butylcyanuric acid |
| Butyl-[1,3,5]triazintrion |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1-butyl |
| butyl-[1,3,5]triazinetrione |
| monobutyl isocyanurate |