1,3,4-Oxadiazole, 2,5-bis(3-methylphenyl)
Modify Date: 2026-06-19 17:03:08
1,3,4-Oxadiazole, 2,5-bis(3-methylphenyl) structure
|
Common Name | 1,3,4-Oxadiazole, 2,5-bis(3-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 5302-87-4 | Molecular Weight | 250.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,4-Oxadiazole, 2,5-bis(3-methylphenyl) |
|---|
| Molecular Formula | C16H14N2O |
|---|---|
| Molecular Weight | 250.29 |
| InChIKey | OHWQVYVPAAGBHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NN=C(O2)C3=CC=CC(=C3)C |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 3, Current Page 1 of 1
1