(2E,4E)-()-3,7,11-trimethyldodeca-2,4-dienoic acid structure
|
Common Name | (2E,4E)-()-3,7,11-trimethyldodeca-2,4-dienoic acid | ||
|---|---|---|---|---|
| CAS Number | 53023-67-9 | Molecular Weight | 238.36600 | |
| Density | 0.921g/cm3 | Boiling Point | 357.2ºC at 760 mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.6ºC | |
| Name | (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.921g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760 mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | 258.6ºC |
| Exact Mass | 238.19300 |
| PSA | 37.30000 |
| LogP | 4.42600 |
| Index of Refraction | 1.476 |
| InChIKey | QMVSVDPAWIVPNR-YMOPAIQUSA-N |
| SMILES | CC(C=CCC(C)CCCC(C)C)=CC(=O)O |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| (2E,4E)-(1)-3,7,11-Trimethyldodeca-2,4-dienoic acid |
| 2,4-Dodecadienoic acid,3,7,11-trimethyl-,(2E,4E) |
| EINECS 258-307-2 |
| cis 3,7,11-trimethyldodeca-2,4-dienoic acid |
| 3,7,11-Trimethyl-trans-2,trans-4-dodecadiensaeure |
| Hydroprene acid |
| dl-3,7,11-Trimethyl-trans-2-trans-4-dodecadiencarbonsaeure |