N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-propylfuran-2-carboxamide
Modify Date: 2024-02-01 16:52:34
![N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-propylfuran-2-carboxamide Structure](https://image.chemsrc.com/caspic/267/5305-61-3.png)
N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-propylfuran-2-carboxamide structure
|
Common Name | N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-propylfuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5305-61-3 | Molecular Weight | 324.37400 | |
| Density | 1.188g/cm3 | Boiling Point | 539.9ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-propylfuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 539.9ºC at 760 mmHg |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.37400 |
| Flash Point | 280.3ºC |
| Exact Mass | 324.14700 |
| PSA | 66.57000 |
| LogP | 3.89420 |
| Index of Refraction | 1.577 |
| InChIKey | KOZSENGMSZXTSB-UHFFFAOYSA-N |
| SMILES | CCCN(Cc1cc2cccc(C)c2[nH]c1=O)C(=O)c1ccco1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-[(8-methyl-2-oxo-1h-quinolin-3-yl)methyl]-n-propyl-furan-2-carboxamide |