N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide
Modify Date: 2025-09-23 20:41:52
N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide structure
|
Common Name | N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 53056-50-1 | Molecular Weight | 316.44100 | |
| Density | 1.298g/cm3 | Boiling Point | 537.9ºC at 760 mmHg | |
| Molecular Formula | C16H16N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.1ºC | |
| Name | N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 537.9ºC at 760 mmHg |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.44100 |
| Flash Point | 279.1ºC |
| Exact Mass | 316.07000 |
| PSA | 86.43000 |
| LogP | 4.63130 |
| Index of Refraction | 1.669 |
| InChIKey | WGFLZYVZLXNDCX-UHFFFAOYSA-N |
| SMILES | CSCCNC(=O)N1c2ccccc2Sc2ccccc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10H-Phenothiazine-10-carboxamide,N-(2-(methylthio)ethyl) |
| N-(2-Methylmercaptoethyl)phenothiazin-10-carboxamid |
| N-(2-(Methylthio)ethyl)-10H-phenothiazine-10-carboxamide |
| phenothiazine-10-carboxylic acid 2-methylsulfanyl-ethylamide |