ajmalan-17(R),21α-diol, compound with 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione (1:1) structure
|
Common Name | ajmalan-17(R),21α-diol, compound with 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5306-82-1 | Molecular Weight | 310.35200 | |
| Density | 1.2g/cm3 | Boiling Point | 459ºC at 760 mmHg | |
| Molecular Formula | C20H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | 6-methyl-4,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 459ºC at 760 mmHg |
| Molecular Formula | C20H14N4 |
| Molecular Weight | 310.35200 |
| Flash Point | 231.4ºC |
| Exact Mass | 310.12200 |
| PSA | 54.50000 |
| LogP | 4.26758 |
| Index of Refraction | 1.674 |
| InChIKey | OABKLXSTDIQNIN-UHFFFAOYSA-N |
| SMILES | Cc1c(C#N)c2ncnc(-c3ccccc3)c2n1-c1ccccc1 |