2,4,6-Triphenyl-s-trithiane
2,4,6-Triphenyl-s-trithiane structure
|
Common Name | 2,4,6-Triphenyl-s-trithiane | ||
|---|---|---|---|---|
| CAS Number | 531-05-5 | Molecular Weight | 366.56300 | |
| Density | 1.232g/cm3 | Boiling Point | 543.7ºC at 760 mmHg | |
| Molecular Formula | C21H18S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-triphenyl-1,3,5-trithiane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 543.7ºC at 760 mmHg |
| Molecular Formula | C21H18S3 |
| Molecular Weight | 366.56300 |
| Flash Point | 292.8ºC |
| Exact Mass | 366.05700 |
| PSA | 75.90000 |
| LogP | 7.29600 |
| Index of Refraction | 1.674 |
| InChIKey | HJHSNTOTXYILIV-UHFFFAOYSA-N |
| SMILES | c1ccc(C2SC(c3ccccc3)SC(c3ccccc3)S2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 3 | |
CAS#:100-52-7
CAS#:120800-97-7
CAS#:16302-98-0
CAS#:79841-55-7
CAS#:108-24-7
CAS#:98-87-3
CAS#:7647-01-0
CAS#:7519-74-6
CAS#:65-85-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-Trithiane,2,4,6-triphenyl |
| 2,6-Triphenyl-s-trithiane |
| s-Trithiane,4,6-triphenyl |
| Triphenyl-s-trithiane |
| 2,4,6-Triphenyl-s-trithiane |
| Trithiobenzaldehyde |
| unsym-1,3,5-triphenyltrithiane |
| 2,4,6-triphenyl-1,3,5-trithiacyclohexane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: LogP of 2,4,6-triphenyl-1,3,5-trithiane is 7.29600. |
| Q: What is the boiling point of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: Boiling point of 2,4,6-triphenyl-1,3,5-trithiane is 543.7ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: Polar surface area (PSA) of 2,4,6-triphenyl-1,3,5-trithiane is 75.90000. |
| Q: What is the English name of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: The English name of 2,4,6-triphenyl-1,3,5-trithiane is 2,4,6-triphenyl-1,3,5-trithiane. |
| Q: What is the Chinese name of 531-05-5? |
| A: Chinese name of 531-05-5 is 531-05-5. |
| Q: What are the upstream materials of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: Related upstream materials(CAS) of 2,4,6-triphenyl-1,3,5-trithiane: 100-52-7;120800-97-7;16302-98-0;79841-55-7;108-24-7;98-87-3;7647-01-0;7519-74-6. |
| Q: What English synonyms does 2,4,6-triphenyl-1,3,5-trithiane have? |
| A: English synonyms of 2,4,6-triphenyl-1,3,5-trithiane: 1,3,5-Trithiane,2,4,6-triphenyl, 2,6-Triphenyl-s-trithiane, s-Trithiane,4,6-triphenyl, Triphenyl-s-trithiane, 2,4,6-Triphenyl-s-trithiane, Trithiobenzaldehyde, unsym-1,3,5-triphenyltrithiane, 2,4,6-triphenyl-1,3,5-trithiacyclohexane. |
| Q: What is the CAS number of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: CAS number of 2,4,6-triphenyl-1,3,5-trithiane is 531-05-5. |
| Q: What is the molecular formula of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: Molecular formula of 2,4,6-triphenyl-1,3,5-trithiane is C21H18S3. |
| Q: What is the SMILES notation of 2,4,6-triphenyl-1,3,5-trithiane? |
| A: SMILES notation of 2,4,6-triphenyl-1,3,5-trithiane is c1ccc(C2SC(c3ccccc3)SC(c3ccccc3)S2)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |