2-[(4-carbamoylphenyl)-(carboxymethylsulfanyl)arsanyl]sulfanylacetic acid structure
|
Common Name | 2-[(4-carbamoylphenyl)-(carboxymethylsulfanyl)arsanyl]sulfanylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 531-72-6 | Molecular Weight | 377.26800 | |
| Density | N/A | Boiling Point | 615.7ºC at 760mmHg | |
| Molecular Formula | C11H12AsNO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.1ºC | |
| Name | 2-[(4-carbamoylphenyl)-(carboxymethylsulfanyl)arsanyl]sulfanylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 615.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H12AsNO5S2 |
| Molecular Weight | 377.26800 |
| Flash Point | 326.1ºC |
| Exact Mass | 376.93700 |
| PSA | 168.29000 |
| LogP | 0.81660 |
| InChIKey | YBQWEUNEYYXYOI-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc([As](SCC(=O)O)SCC(=O)O)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
2-[(4-carbamoyl... CAS#:531-72-6 |
| Literature: Gough; King Journal of the Chemical Society, 1930 , p. 669,683 Full Text Show Details Maren Journal of the American Chemical Society, 1946 , vol. 68, p. 1864 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Capariside |
| Arsenamide |
| p-(Bis(carboxymethylmercapto)arsino)benzamide |
| 4-Carbamoyl-phenyldithioarsonigsaeure-bis-carboxymethylester |
| Bis(carboxymethylmercapto)(p-carbamylphenyl)-arsine |
| (4-carbamoyl-phenylarsanediyldimercapto)-di-acetic acid |
| Thiacetarsamide |
| Bis-carboxymethylmercapto-(4-carbamoyl-phenyl)-arsin |
| Dithioglycolyl p-arsenobenzamide |
| bis(carboxymethylmercapto) (p-carbamoylphenyl)arsine |
| (4-Carbamoyl-phenylarsandiyldimercapto)-di-essigsaeure |
| Thioarsenite |
| Thiacetarsamidum |
| 4-Carbamylphenyl bis(carboxymethylthio)arsenite |