(E)-3-[3-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid structure
|
Common Name | (E)-3-[3-[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 5310-51-0 | Molecular Weight | 255.18400 | |
| Density | 1.358g/cm3 | Boiling Point | 458.7ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | N-(2,4-Dinitro-phenyl)-glycin-methylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 458.7ºC at 760 mmHg |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.18400 |
| Flash Point | 245.3ºC |
| Exact Mass | 255.04900 |
| PSA | 129.97000 |
| LogP | 2.20730 |
| Index of Refraction | 1.686 |
| InChIKey | UGQLSPNTUYLLSP-UHFFFAOYSA-N |
| SMILES | COC(=O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~51%
(E)-3-[3-[(E)-2... CAS#:5310-51-0 |
| Literature: Alekshun, Michael N.; Amoo, Victor; Kim, Oak K.; Verma, Atul K. Patent: US2006/160799 A1, 2006 ; Location in patent: Page/Page column 366-367 ; |
|
~%
(E)-3-[3-[(E)-2... CAS#:5310-51-0 |
| Literature: Paratek Pharmaceuticals, Inc. Patent: US2005/124678 A1, 2005 ; |
|
~63%
(E)-3-[3-[(E)-2... CAS#:5310-51-0 |
| Literature: Machacek, Vladimir; Sterba, Vojeslav; Kolb, Ivan; Lycka, Antonin Collection of Czechoslovak Chemical Communications, 1988 , vol. 53, # 5 p. 1044 - 1052 |
|
~%
(E)-3-[3-[(E)-2... CAS#:5310-51-0 |
| Literature: Fletcher et al. Biochemical Journal, 1954 , vol. 56, p. 106,107 |
|
~%
(E)-3-[3-[(E)-2... CAS#:5310-51-0 |
| Literature: Fletcher et al. Biochemical Journal, 1954 , vol. 56, p. 106,107 |
| N-ethyl-2,4-dinitro-aniline |
| N-(2,4-dinitrophenyl)ethylamine |
| N-ethyl-2,4-dinitro-benzenamine |
| N-(2,4-dinitrophenyl)-N-ethylamine |
| Dnp-glycin-methylester |
| (2,4-dinitro-phenylamino)-acetic acid methyl ester |
| N1-ethyl-2,4-dinitroaniline |
| 2,4-Dinitro-N-ethylaniline |
| Benzenamine,N-ethyl-2,4-dinitro |
| N-Aethyl-2,4-dinitro-anilin |
| (2,4-dinitrophenyl)ethylamine |
| N-(2,4-dinitro-phenyl)-glycine methyl ester |