(2,6-dichlorophenyl)-(4,5-dihydro-1H-imidazol-2-yl)methanol structure
|
Common Name | (2,6-dichlorophenyl)-(4,5-dihydro-1H-imidazol-2-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 53103-46-1 | Molecular Weight | 245.10500 | |
| Density | 1.51g/cm3 | Boiling Point | 436.7ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9ºC | |
| Name | (2,6-dichlorophenyl)-(4,5-dihydro-1H-imidazol-2-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 436.7ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.10500 |
| Flash Point | 217.9ºC |
| Exact Mass | 244.01700 |
| PSA | 44.62000 |
| LogP | 1.79290 |
| Index of Refraction | 1.659 |
| InChIKey | ODBTYWLKQRMUBB-UHFFFAOYSA-N |
| SMILES | OC(C1=NCCN1)c1c(Cl)cccc1Cl |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| St 1965 |
| (2,6-dichloro-phenyl)-(4,5-dihydro-1H-imidazol-2-yl)-methanol |