ent-Corey PG-Lactone Diol structure
|
Common Name | ent-Corey PG-Lactone Diol | ||
|---|---|---|---|---|
| CAS Number | 53110-06-8 | Molecular Weight | 268.349 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 458.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8±22.2 °C | |
Use of ent-Corey PG-Lactone Diolent-Corey PG-lactone diol is the opposite enantiomer of corey PG-lactone diol. |
| Name | (3aS,4S,6R,6aS)-6-Hydroxy-4-[(1E,3R)-3-hydroxy-1-octen-1-yl]hexah ydro-2H-cyclopenta[b]furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.7±45.0 °C at 760 mmHg |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.349 |
| Flash Point | 168.8±22.2 °C |
| Exact Mass | 268.167450 |
| PSA | 66.76000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | HWJOPRRQCMFHNY-KVPZUBJNSA-N |
| SMILES | CCCCCC(O)C=CC1CC(O)C2OC(=O)CC12 |
| 2H-Cyclopenta[b]furan-2-one, hexahydro-6-hydroxy-4-[(1E,3R)-3-hydroxy-1-octen-1-yl]-, (3aS,4S,6R,6aS)- |
| (3aS,4S,6R,6aS)-6-Hydroxy-4-[(1E,3R)-3-hydroxy-1-octen-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one |
| Losindole |