2-[carboxylatomethyl(carboxymethyl)amino]acetate,mercury(2+) structure
|
Common Name | 2-[carboxylatomethyl(carboxymethyl)amino]acetate,mercury(2+) | ||
|---|---|---|---|---|
| CAS Number | 53113-61-4 | Molecular Weight | 389.71300 | |
| Density | N/A | Boiling Point | 498.2ºC at 760 mmHg | |
| Molecular Formula | C6H7HgNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.1ºC | |
| Name | 2-[carboxylatomethyl(carboxymethyl)amino]acetate,mercury(2+) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 498.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H7HgNO6 |
| Molecular Weight | 389.71300 |
| Flash Point | 255.1ºC |
| Exact Mass | 390.99800 |
| PSA | 120.80000 |
| InChIKey | OSAAFARUUMOURR-UHFFFAOYSA-L |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)O.[Hg+2] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Mercurate(1-),(N,N-bis(carboxymethyl)glycinato(3-)-N,O,O',O'')-,hydrogen,(T-4) |
| Mercury(2+) NTA |