2-methoxy-N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide structure
|
Common Name | 2-methoxy-N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 53123-07-2 | Molecular Weight | 346.46700 | |
| Density | 1.294g/cm3 | Boiling Point | 584.8ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.5ºC | |
| Name | 2-methoxy-N-(2-methylsulfanylethyl)phenothiazine-10-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 584.8ºC at 760 mmHg |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.46700 |
| Flash Point | 307.5ºC |
| Exact Mass | 346.08100 |
| PSA | 95.66000 |
| LogP | 4.63990 |
| Index of Refraction | 1.65 |
| InChIKey | UPNGBHXCFZCJMB-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)N(C(=O)NCCSC)c1ccccc1S2 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10H-Phenothiazine-10-carboxamide,2-methoxy-N-(2-(methylthio)ethyl) |
| 2-Methoxy-N-(2-(methylthio)ethyl)-10H-phenothiazine-10-carboxamide |