9H-Purine-8-methanol,6-amino-, 8-acetate structure
|
Common Name | 9H-Purine-8-methanol,6-amino-, 8-acetate | ||
|---|---|---|---|---|
| CAS Number | 53130-86-2 | Molecular Weight | 207.18900 | |
| Density | 1.68g/cm3 | Boiling Point | 364.9ºC at 760mmHg | |
| Molecular Formula | C8H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | (6-amino-7H-purin-8-yl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 364.9ºC at 760mmHg |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.18900 |
| Flash Point | 174.5ºC |
| Exact Mass | 207.07600 |
| PSA | 106.78000 |
| LogP | 0.57940 |
| Index of Refraction | 1.758 |
| InChIKey | ULXCKGMHUKQDJL-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1nc2ncnc(N)c2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Purine-8-methanol,acetate (ester) |
| (6-Amino-9H-purin-8-yl)methyl acetate |
| 1H-Purine-8-methanol,6-amino-,acetate (ester) |
| 8-acetoxymethyl-7(9)H-purin-6-ylamine |