Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester structure
|
Common Name | Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 53132-07-3 | Molecular Weight | 312.40300 | |
| Density | 1.056g/cm3 | Boiling Point | 444.2ºC at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | Benzoic acid, 4-methyl-, 4-(hexyloxy)phenyl ester |
|---|
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 444.2ºC at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 190ºC |
| Exact Mass | 312.17300 |
| PSA | 35.53000 |
| LogP | 5.17330 |
| Index of Refraction | 1.538 |
| InChIKey | XZQAFICUHVFVKG-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |