3-hydroxy-N-(3-methylphenyl)naphthalene-2-carboxamide structure
|
Common Name | 3-hydroxy-N-(3-methylphenyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 53151-08-9 | Molecular Weight | 277.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-N-(3-methylphenyl)naphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO2 |
|---|---|
| Molecular Weight | 277.31700 |
| Exact Mass | 277.11000 |
| PSA | 52.82000 |
| LogP | 4.49010 |
| InChIKey | OREAWEBREZGCOJ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)c2cc3ccccc3cc2O)c1 |
|
~70%
3-hydroxy-N-(3-... CAS#:53151-08-9 |
| Literature: Kos, Jiri; Zadrazilova, Iveta; Pesko, Matus; Keltosova, Stanislava; Tengler, Jan; Gonec, Tomas; Bobal, Pavel; Kauerova, Tereza; Oravec, Michal; Kollar, Peter; Cizek, Alois; Kralova, Katarina; Jampilek, Josef Molecules, 2013 , vol. 18, # 7 p. 7977 - 7997 |
|
~%
3-hydroxy-N-(3-... CAS#:53151-08-9 |
| Literature: Vattipalli, Ramya; Shirodkar, Prabhakar Y.; Somani, Rakesh R.; Kadam, Vilasrao J. Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2008 , vol. 47, # 10 p. 1587 - 1590 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: ST_JUDE: Plasmodium falciparum K1 EC50 (uM) as measured by SYBR green dye
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL730080
|
|
Name: ST_JUDE: Plasmodium falciparum 3D7 EC50 (uM) as measured by SYBR green dye
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL730079
|
| 2-Hydroxy-3-naphthoesaeure-m-toluidid |
| 3-hydroxy-[2]naphthoic acid m-toluidide |
| 3-Hydroxy-[2]naphthoesaeure-m-toluidid |