2-oxo-2H-1-benzopyran-3-carboxylic acid, compound with [R-(R*,S*)]-2-(methylamino)-1-phenylpropanol (1:1) structure
|
Common Name | 2-oxo-2H-1-benzopyran-3-carboxylic acid, compound with [R-(R*,S*)]-2-(methylamino)-1-phenylpropanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 53166-67-9 | Molecular Weight | 355.38400 | |
| Density | N/A | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.7ºC | |
| Name | 2-(methylamino)-1-phenylpropan-1-ol,2-oxochromene-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 388.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.38400 |
| Flash Point | 162.7ºC |
| Exact Mass | 355.14200 |
| PSA | 99.77000 |
| LogP | 3.21000 |
| InChIKey | QKWOGZAIBLZHBU-UHFFFAOYSA-N |
| SMILES | CNC(C)C(O)c1ccccc1.O=C(O)c1cc2ccccc2oc1=O |
| einecs 258-405-5 |