N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(2-nitrophenyl)methanimine structure
|
Common Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(2-nitrophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 5317-77-1 | Molecular Weight | 373.42800 | |
| Density | 1.31g/cm3 | Boiling Point | 584.3ºC at 760 mmHg | |
| Molecular Formula | C21H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.1ºC | |
| Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-1-(2-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 584.3ºC at 760 mmHg |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.42800 |
| Flash Point | 307.1ºC |
| Exact Mass | 373.08800 |
| PSA | 99.31000 |
| LogP | 6.45370 |
| Index of Refraction | 1.687 |
| InChIKey | ZKKBLLFPQHQTPV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(N=Cc4ccccc4[N+](=O)[O-])cc3)sc2c1 |
|
~%
N-[4-(6-methyl-... CAS#:5317-77-1 |
| Literature: Uloth; Kirk; Gould; Larsen Journal of medicinal chemistry, 1966 , vol. 9, # 1 p. 88 - 97 |
|
~%
N-[4-(6-methyl-... CAS#:5317-77-1 |
| Literature: Uloth; Kirk; Gould; Larsen Journal of medicinal chemistry, 1966 , vol. 9, # 1 p. 88 - 97 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-[4-(6-METHYLBENZOTHIAZOL-2-YL)PHENYL]-1-(2-NITROPHENYL)METHANIMINE |
| 4-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(2-nitrophenyl)methylidene]aniline |