3-(3,5-ditert-butyl-4-hydroxyphenyl)-N,N-dimethylpropanamide structure
|
Common Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N,N-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 5319-26-6 | Molecular Weight | 305.45500 | |
| Density | 0.991g/cm3 | Boiling Point | 390.5ºC at 760mmHg | |
| Molecular Formula | C19H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N,N-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.991g/cm3 |
|---|---|
| Boiling Point | 390.5ºC at 760mmHg |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.45500 |
| Flash Point | 190ºC |
| Exact Mass | 305.23500 |
| PSA | 40.54000 |
| LogP | 4.00800 |
| Index of Refraction | 1.51 |
| InChIKey | ASGAWNQITWKWHX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|
~%
3-(3,5-ditert-b... CAS#:5319-26-6 |
| Literature: Golfier,M.; Milcent,R. Journal of Heterocyclic Chemistry, 1973 , vol. 10, p. 989 - 991 |
|
~%
3-(3,5-ditert-b... CAS#:5319-26-6 |
| Literature: Martin,D.; Weise,A. Chemische Berichte, 1966 , vol. 99, p. 317 - 327 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Phenoxy-2-phenyl-1.3.4-oxdiazol |
| 2-Phenyl-5-phenoxy-1,3,4-oxadiazol |
| HMS1580J08 |
| 2-Phenoxy-5-phenyl-1,3,4-oxadiazol |
| 2-phenoxy-5-phenyl-[1,3,4]oxadiazole |