4(3H)-Quinazolinone,3-hydroxy-2-phenyl- structure
|
Common Name | 4(3H)-Quinazolinone,3-hydroxy-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5319-72-2 | Molecular Weight | 238.24100 | |
| Density | 1.3g/cm3 | Boiling Point | 447.6ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 3-hydroxy-2-phenylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 447.6ºC at 760 mmHg |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24100 |
| Flash Point | 224.5ºC |
| Exact Mass | 238.07400 |
| PSA | 55.12000 |
| LogP | 2.30080 |
| Index of Refraction | 1.669 |
| InChIKey | MIMZZMIFKADVDD-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-2-phenyl-3H-quinazolin-4-one |
| 3-hydroxy-2-phenyl-3,4-dihydroquinazolin-4-one |
| 3-Hydroxy-4-oxo-2-phenyl-3.4-dihydro-chinazolin |