3-(2-chloroethyl)-1,3-diazaspiro[4.5]decane-2,4-dione structure
|
Common Name | 3-(2-chloroethyl)-1,3-diazaspiro[4.5]decane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 53195-97-4 | Molecular Weight | 230.69100 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-chloroethyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69100 |
| Exact Mass | 230.08200 |
| PSA | 49.41000 |
| LogP | 1.74660 |
| Index of Refraction | 1.555 |
| InChIKey | BNSSNUHBZCULQA-UHFFFAOYSA-N |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CCCl |
|
~%
3-(2-chloroethy... CAS#:53195-97-4 |
| Literature: The United States of America as represented by the Secretary of State Patent: US4105774 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,5-Pentamethylene-3-(2'-chlorethyl)hydantoin |
| 5,5-Pentamethylen-3-(2'-chlorethyl)-hydantoin |
| 3-(2-chloro-ethyl)-1,3-diaza-spiro[4.5]decane-2,4-dione |
| 2-(2-chloroethyl)-2,4-diazaspiro[4.5]decane-1,3-dione |