2-Propenoic acid,3-phenyl-, 2-methoxy-4-(2-propen-1-yl)phenyl ester
Modify Date: 2025-09-18 18:05:25
2-Propenoic acid,3-phenyl-, 2-methoxy-4-(2-propen-1-yl)phenyl ester structure
|
Common Name | 2-Propenoic acid,3-phenyl-, 2-methoxy-4-(2-propen-1-yl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 532-08-1 | Molecular Weight | 294.34400 | |
| Density | 1.113g/cm3 | Boiling Point | 452ºC at 760mmHg | |
| Molecular Formula | C19H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.7ºC | |
| Name | Eugenol cinnamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 452ºC at 760mmHg |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.34400 |
| Flash Point | 193.7ºC |
| Exact Mass | 294.12600 |
| PSA | 35.53000 |
| LogP | 4.04250 |
| Index of Refraction | 1.588 |
| InChIKey | SJKFNIODBSUYID-ACCUITESSA-N |
| SMILES | C=CCc1ccc(OC(=O)C=Cc2ccccc2)c(OC)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Methoxy-4-(2-propenyl)phenol 3-phenylpropenoate |
| Zimtsaeure-(2-methoxy-4-allyl-phenylester) |
| cinnamic acid eugenyl ester |
| Einecs 208-526-4 |
| 4-allyl-2-methoxyphenyl cinnamate |
| Cinnamyl eugenol |
| trans-cinnamic acid-(4-allyl-2-methoxy-phenyl ester) |
| trans-Zimtsaeure-(4-allyl-2-methoxy-phenylester) |