3-(dimethylamino)-1,2-dimethylpropyl p-aminobenzoate monohydrochloride
Modify Date: 2025-08-24 19:51:12
3-(dimethylamino)-1,2-dimethylpropyl p-aminobenzoate monohydrochloride structure
|
Common Name | 3-(dimethylamino)-1,2-dimethylpropyl p-aminobenzoate monohydrochloride | ||
|---|---|---|---|---|
| CAS Number | 532-62-7 | Molecular Weight | 286.79800 | |
| Density | N/A | Boiling Point | 375.8ºC at 760mmHg | |
| Molecular Formula | C14H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | [4-(dimethylamino)-3-methylbutan-2-yl] 4-aminobenzoate,hydrochloride |
|---|
| Boiling Point | 375.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.79800 |
| Flash Point | 181.1ºC |
| Exact Mass | 286.14500 |
| PSA | 55.56000 |
| LogP | 3.39500 |
| InChIKey | ZGKJESGFAPAQKB-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)C(C)OC(=O)c1ccc(N)cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |