4-bromo-3-chloro-N-[(Z)-indol-3-ylidenemethyl]aniline
Modify Date: 2025-09-27 18:07:04
![4-bromo-3-chloro-N-[(Z)-indol-3-ylidenemethyl]aniline Structure](https://image.chemsrc.com/caspic/053/5320-03-6.png)
4-bromo-3-chloro-N-[(Z)-indol-3-ylidenemethyl]aniline structure
|
Common Name | 4-bromo-3-chloro-N-[(Z)-indol-3-ylidenemethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 5320-03-6 | Molecular Weight | 333.61000 | |
| Density | 1.51g/cm3 | Boiling Point | 463.6ºC at 760 mmHg | |
| Molecular Formula | C15H10BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | 4-bromo-3-chloro-N-[(Z)-indol-3-ylidenemethyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 463.6ºC at 760 mmHg |
| Molecular Formula | C15H10BrClN2 |
| Molecular Weight | 333.61000 |
| Flash Point | 234.2ºC |
| Exact Mass | 331.97200 |
| PSA | 24.39000 |
| LogP | 4.78000 |
| Index of Refraction | 1.671 |
| InChIKey | FKJNVCFBBHYMQG-UHFFFAOYSA-N |
| SMILES | Clc1cc(N=Cc2c[nH]c3ccccc23)ccc1Br |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromo-3-chloro-N-(1H-indol-3-ylmethylene)aniline |
| 4-bromo-3-chloro-N-[(E)-1H-indol-3-ylmethylidene]aniline |