Methanone,1,1'-(1,2-diazenediyl)bis[1-(4-methyl-1-piperazinyl)- structure
|
Common Name | Methanone,1,1'-(1,2-diazenediyl)bis[1-(4-methyl-1-piperazinyl)- | ||
|---|---|---|---|---|
| CAS Number | 53202-52-1 | Molecular Weight | 282.34200 | |
| Density | 1.31g/cm3 | Boiling Point | 382.6ºC at 760mmHg | |
| Molecular Formula | C12H22N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | 4-methyl-N-(4-methylpiperazine-1-carbonyl)iminopiperazine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760mmHg |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.34200 |
| Flash Point | 185.2ºC |
| Exact Mass | 282.18000 |
| PSA | 71.82000 |
| Index of Refraction | 1.627 |
| InChIKey | KKAJOAPHSIINCB-BUHFOSPRSA-N |
| SMILES | CN1CCN(C(=O)N=NC(=O)N2CCN(C)CC2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Azodicarbonsaeuredi(N'-methyl-(N)-piperazin) |
| diazenedicarboxylic acid bis(N'-methylpiperazide) |
| bis-(4-methyl-piperazine-1-carbonyl)-diazene |
| 1,2-Diazendicarbonsaeure-bis(N-methylpiperazid) |
| 4,4'-dimethyl-1,1'-(2,3-diaza-but-2-enedioyl)-bis-piperazine |
| azodicarbonic acid di-(N'-methyl-(N)-piperazine) |