2-ethylhexyl 5,5-dibutyl-12-ethyl-9-oxo-10-oxa-4,6-dithia-5-stannahexadecanoate structure
|
Common Name | 2-ethylhexyl 5,5-dibutyl-12-ethyl-9-oxo-10-oxa-4,6-dithia-5-stannahexadecanoate | ||
|---|---|---|---|---|
| CAS Number | 53202-61-2 | Molecular Weight | 667.62600 | |
| Density | N/A | Boiling Point | 285.9ºC at 760mmHg | |
| Molecular Formula | C30H60O4S2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4ºC | |
| Name | 2-ethylhexyl 3-[dibutyl-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanylstannyl]sulfanylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 285.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C30H60O4S2Sn |
| Molecular Weight | 667.62600 |
| Flash Point | 148.4ºC |
| Exact Mass | 668.29500 |
| PSA | 52.60000 |
| LogP | 8.22640 |
| InChIKey | RFPITRAFRHNSRB-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)COC(=O)CCS[Sn](CCCC)(CCCC)SCCC(=O)OCC(CC)CCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 10-Oxa-4,6-dithia-5-stannahexadecanoic acid,5,5-dibutyl-12-ethyl-9-oxo-,2-ethylhexyl ester |
| Dibutyltinbis(2-ethylhexyl 3-mercaptopropionate) |
| 2-ethylhexyl 5,5-dibutyl-12-ethyl-9-oxo-10-oxa-4,6-dithia-5-stannahexadecanoate |
| EINECS 258-428-0 |