[3,4-diacetyloxy-5-(2,5-dioxopyrrol-1-yl)oxolan-2-yl]methyl acetate structure
|
Common Name | [3,4-diacetyloxy-5-(2,5-dioxopyrrol-1-yl)oxolan-2-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 53209-76-0 | Molecular Weight | 355.29700 | |
| Density | 1.42g/cm3 | Boiling Point | 478.9ºC at 760 mmHg | |
| Molecular Formula | C15H17NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | [3,4-diacetyloxy-5-(2,5-dioxopyrrol-1-yl)oxolan-2-yl]methyl acetate |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 478.9ºC at 760 mmHg |
| Molecular Formula | C15H17NO9 |
| Molecular Weight | 355.29700 |
| Flash Point | 243.4ºC |
| Exact Mass | 355.09000 |
| PSA | 125.51000 |
| Index of Refraction | 1.541 |
| InChIKey | QBLWQLZBDIMNGG-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1OC(N2C(=O)C=CC2=O)C(OC(C)=O)C1OC(C)=O |
|
~84%
[3,4-diacetylox... CAS#:53209-76-0 |
| Literature: Numao; Hemmi; Naujokaitis; Rabinovitz; Beisler Journal of Medicinal Chemistry, 1981 , vol. 24, # 5 p. 515 - 520 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |