5-tert-butyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrazole-3-carboxamide structure
|
Common Name | 5-tert-butyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5321-57-3 | Molecular Weight | 276.35700 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H16N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-tert-butyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.35700 |
| Exact Mass | 276.10400 |
| PSA | 101.87000 |
| LogP | 3.10740 |
| Index of Refraction | 1.635 |
| InChIKey | GELFMYFARBCDEO-RIYZIHGNSA-N |
| SMILES | CC(C)(C)c1cc(C(=O)NN=Cc2cccs2)n[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-tert-Butyl-2H-pyrazole-3-carboxylic acid thiophen-2-ylmethylene-hydrazide |
| 2-phenyl-4-pyrazin-2-yl-butyronitrile |
| 2-Phenyl-4-pyrazyl-buttersaeure-nitril |