N-(3,5-dichlorophenyl)-2-hydroxysuccinamic acid structure
|
Common Name | N-(3,5-dichlorophenyl)-2-hydroxysuccinamic acid | ||
|---|---|---|---|---|
| CAS Number | 53219-96-8 | Molecular Weight | 278.08900 | |
| Density | 1.617g/cm3 | Boiling Point | 555.9ºC at 760mmHg | |
| Molecular Formula | C10H9Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290ºC | |
| Name | 4-(3,5-dichloroanilino)-2-hydroxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.617g/cm3 |
|---|---|
| Boiling Point | 555.9ºC at 760mmHg |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.08900 |
| Flash Point | 290ºC |
| Exact Mass | 276.99100 |
| PSA | 90.12000 |
| LogP | 2.41700 |
| Index of Refraction | 1.649 |
| InChIKey | XBHKNWDHVCOOIV-UHFFFAOYSA-N |
| SMILES | O=C(CC(O)C(=O)O)Nc1cc(Cl)cc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~44%
N-(3,5-dichloro... CAS#:53219-96-8 |
| Literature: Shih, Hsiencheng; Rankin, Gary O. Synthesis, 1989 , # 11 p. 866 - 867 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D,L-N-(3,5-Dichlorophenyl)-2-hydroxysuccinamic acid |
| 4-((3,5-Dichlorophenyl)amino)-2-hydroxy-4-oxobutanoic acid |
| N-(3,5-Dichlorophenyl)-2-hydroxysuccinamic acid |
| N-(3,5-dichlorophenyl)-2-hydroxysuccinamic acid monoamide |
| NDHSA |