Hexanoic acid,2-ethyl-, 1-methyl-2-oxo-2-(phenylamino)ethyl ester structure
|
Common Name | Hexanoic acid,2-ethyl-, 1-methyl-2-oxo-2-(phenylamino)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5323-69-3 | Molecular Weight | 291.38500 | |
| Density | 1.058g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C17H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | (1-anilino-1-oxopropan-2-yl) 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.38500 |
| Flash Point | 220.9ºC |
| Exact Mass | 291.18300 |
| PSA | 55.40000 |
| LogP | 3.84620 |
| Index of Refraction | 1.521 |
| InChIKey | OWGNFZPHTFMKSU-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OC(C)C(=O)Nc1ccccc1 |
|
~%
Hexanoic acid,2... CAS#:5323-69-3 |
| Literature: Fein; Filachione Journal of the American Chemical Society, 1953 , vol. 75, p. 2097 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-ethyl-hexanoyloxy)-propionic acid anilide |
| 2-(2-Aethyl-hexanoyloxy)-propionsaeure-anilid |
| 1-oxo-1-(phenylamino)propan-2-yl 2-ethylhexanoate |