3-hydroxy-N-[(5-methoxy-2-nitro-4-phenylmethoxy-phenyl)methylideneamino]naphthalene-2-carboxamide structure
|
Common Name | 3-hydroxy-N-[(5-methoxy-2-nitro-4-phenylmethoxy-phenyl)methylideneamino]naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5324-15-2 | Molecular Weight | 319.15000 | |
| Density | 1.466g/cm3 | Boiling Point | 433.5ºC at 760 mmHg | |
| Molecular Formula | C15H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | benzoic acid, 4-(2-bromoacetyl)phenyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760 mmHg |
| Molecular Formula | C15H11BrO3 |
| Molecular Weight | 319.15000 |
| Flash Point | 216ºC |
| Exact Mass | 317.98900 |
| PSA | 43.37000 |
| LogP | 3.48340 |
| Index of Refraction | 1.612 |
| InChIKey | GKPQAXNEUSDRJJ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1ccc(OC(=O)c2ccccc2)cc1 |
| HS Code | 2916310090 |
|---|
|
~%
3-hydroxy-N-[(5... CAS#:5324-15-2 |
| Literature: NIHON MEDI-PHYSICS CO., LTD. Patent: EP2022792 A1, 2009 ; Location in patent: Page/Page column 10-11; 28 ; |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-Bromacetyl-benzolsulfonsaeure-dimethylamid |
| 4'-benzoyloxy-2-bromoacetophenone |
| 4-bromoacetyl-benzenesulfonic acid dimethylamide |
| 4-bromoacetylphenyl benzoate |
| p-Dimethylaminosulphonylphenacyl bromide |