2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one
2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one structure
|
Common Name | 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5324-70-9 | Molecular Weight | 380.47800 | |
| Density | 1.292g/cm3 | Boiling Point | 660ºC at 760 mmHg | |
| Molecular Formula | C18H20O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440ºC | |
Summary: 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one (Chinese name: 2-(4-甲基苯基)磺酰基-4-甲基磺酰基-1-苯基丁-1-酮, CAS number: 5324-70-9, molecular formula: C18H20O5S2, molecular weight: 380.47800), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 660ºC at 760 mmHg |
| Molecular Formula | C18H20O5S2 |
| Molecular Weight | 380.47800 |
| Flash Point | 440ºC |
| Exact Mass | 380.07500 |
| PSA | 102.11000 |
| LogP | 4.61650 |
| Index of Refraction | 1.572 |
| InChIKey | HAHRXWGCOGMFGI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(CCS(C)(=O)=O)C(=O)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(4-methylphen... CAS#:5324-70-9 |
| Literature: Truce; Wellisch Journal of the American Chemical Society, 1952 , vol. 74, p. 2881 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methanesulfonyl-1-phenyl-2-(toluene-4-sulfonyl)-butan-1-one |
| 2-[(4-methylphenyl)sulfonyl]-4-(methylsulfonyl)-1-phenylbutan-1-one |
| 4-Methansulfonyl-1-phenyl-2-(toluol-4-sulfonyl)-butan-1-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: CAS number of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is 5324-70-9. |
| Q: What is the molecular formula of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: Molecular formula of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is C18H20O5S2. |
| Q: What is the SMILES notation of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: SMILES notation of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is Cc1ccc(S(=O)(=O)C(CCS(C)(=O)=O)C(=O)c2ccccc2)cc1. |
| Q: What is the InChIKey of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: InChIKey of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is HAHRXWGCOGMFGI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: Molecular weight of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is 380.47800. |
| Q: What is the LogP of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: LogP of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is 4.61650. |
| Q: What are the upstream materials of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: Related upstream materials(CAS) of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one: 31378-03-7;3680-02-2. |
| Q: What English synonyms does 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one have? |
| A: English synonyms of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one: 4-methanesulfonyl-1-phenyl-2-(toluene-4-sulfonyl)-butan-1-one, 2-[(4-methylphenyl)sulfonyl]-4-(methylsulfonyl)-1-phenylbutan-1-one, 4-Methansulfonyl-1-phenyl-2-(toluol-4-sulfonyl)-butan-1-on. |
| Q: What is the polar surface area (PSA) of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: Polar surface area (PSA) of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is 102.11000. |
| Q: What is the boiling point of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one? |
| A: Boiling point of 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one is 660ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |