2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one structure
|
Common Name | 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenyl-butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5324-70-9 | Molecular Weight | 380.47800 | |
| Density | 1.292g/cm3 | Boiling Point | 660ºC at 760 mmHg | |
| Molecular Formula | C18H20O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440ºC | |
| Name | 2-(4-methylphenyl)sulfonyl-4-methylsulfonyl-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 660ºC at 760 mmHg |
| Molecular Formula | C18H20O5S2 |
| Molecular Weight | 380.47800 |
| Flash Point | 440ºC |
| Exact Mass | 380.07500 |
| PSA | 102.11000 |
| LogP | 4.61650 |
| Index of Refraction | 1.572 |
| InChIKey | HAHRXWGCOGMFGI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C(CCS(C)(=O)=O)C(=O)c2ccccc2)cc1 |
|
~%
2-(4-methylphen... CAS#:5324-70-9 |
| Literature: Truce; Wellisch Journal of the American Chemical Society, 1952 , vol. 74, p. 2881 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methanesulfonyl-1-phenyl-2-(toluene-4-sulfonyl)-butan-1-one |
| 2-[(4-methylphenyl)sulfonyl]-4-(methylsulfonyl)-1-phenylbutan-1-one |
| 4-Methansulfonyl-1-phenyl-2-(toluol-4-sulfonyl)-butan-1-on |