10H-Phenothiazine-10-propanamine,N,N-diethyl-, N,5-dioxide structure
|
Common Name | 10H-Phenothiazine-10-propanamine,N,N-diethyl-, N,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5325-16-6 | Molecular Weight | 344.47100 | |
| Density | 1.5g/cm3 | Boiling Point | 350.3ºC at 760 mmHg | |
| Molecular Formula | C19H24N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6ºC | |
| Name | 10-[3-(diethylamino)propyl]phenothiazine, 5-dioxide, hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 350.3ºC at 760 mmHg |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.47100 |
| Flash Point | 165.6ºC |
| Exact Mass | 344.15600 |
| PSA | 68.95000 |
| LogP | 5.00090 |
| Index of Refraction | 1.699 |
| InChIKey | FNGDFSQKZGCPMM-UHFFFAOYSA-N |
| SMILES | CC[N+]([O-])(CC)CCCN1c2ccccc2S(=O)c2ccccc21 |
| HS Code | 2934300000 |
|---|
|
~%
10H-Phenothiazi... CAS#:5325-16-6 |
| Literature: Schmalz; Burger Journal of the American Chemical Society, 1954 , vol. 76, p. 5455,5457 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Dietilaminoetossi-difenil-etilene cloridrato [Italian] |
| Diaethyl-[3-(5-brom-furan-2-carbonyloxy)-butyl]-methyl-ammonium,Jodid |
| 4-Dietilaminoetossi-difenil-etilene cloridrato |
| diethyl-[3-(5-bromo-furan-2-carbonyloxy)-butyl]-methyl-ammonium,iodide |