3-Isopropyl-6-methyl-2-(3-dimethylaminopropyloxycarbonylmethoxy)benzoic acid ethyl ester
Modify Date: 2025-11-08 09:14:55
3-Isopropyl-6-methyl-2-(3-dimethylaminopropyloxycarbonylmethoxy)benzoic acid ethyl ester structure
|
Common Name | 3-Isopropyl-6-methyl-2-(3-dimethylaminopropyloxycarbonylmethoxy)benzoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 53251-82-4 | Molecular Weight | 365.46400 | |
| Density | 1.062g/cm3 | Boiling Point | 459.7ºC at 760 mmHg | |
| Molecular Formula | C20H31NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | ethyl 2-[2-[3-(dimethylamino)propoxy]-2-oxoethoxy]-6-methyl-3-propan-2-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 459.7ºC at 760 mmHg |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.46400 |
| Flash Point | 231.8ºC |
| Exact Mass | 365.22000 |
| PSA | 65.07000 |
| LogP | 3.16880 |
| Index of Refraction | 1.502 |
| InChIKey | RKBPFDSABQZWQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)ccc(C(C)C)c1OCC(=O)OCCCN(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetic acid,(2-ethoxycarbonyl-6-isopropyl-3-methyl)phenoxy-,3-(dimethylamino)propyl ester |
| p-Cymene-2-carboxylic acid,3-(3-(dimethylamino)propoxycarbonylmethoxy)-,ethyl ester |