1,2,3-Benzenetriol,5-(2,4,6-trihydroxyphenoxy)- structure
|
Common Name | 1,2,3-Benzenetriol,5-(2,4,6-trihydroxyphenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 53254-99-2 | Molecular Weight | 266.20400 | |
| Density | 1.767g/cm3 | Boiling Point | 566.3ºC at 760mmHg | |
| Molecular Formula | C12H10O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.3ºC | |
| Name | 2-(3,4,5-trihydroxyphenoxy)benzene-1,3,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.767g/cm3 |
|---|---|
| Boiling Point | 566.3ºC at 760mmHg |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.20400 |
| Flash Point | 296.3ºC |
| Exact Mass | 266.04300 |
| PSA | 130.61000 |
| LogP | 1.71250 |
| Index of Refraction | 1.793 |
| InChIKey | PYUFXOMNRPZYTI-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c(Oc2cc(O)c(O)c(O)c2)c(O)c1 |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3,4,5,2',4',6'-Hexahydroxydiphenylether |
| Bifuhalol |
| 2,4,6,3',4',5'-hexahydroxydiphenyl ether |