Methanone, (4-hydroxy-3-methylphenyl)phenyl- structure
|
Common Name | Methanone, (4-hydroxy-3-methylphenyl)phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5326-42-1 | Molecular Weight | 212.24400 | |
| Density | 1.164g/cm3 | Boiling Point | 388ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | (4-hydroxy-3-methylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 165.7ºC |
| Exact Mass | 212.08400 |
| PSA | 37.30000 |
| LogP | 2.93160 |
| Index of Refraction | 1.604 |
| InChIKey | UDGHTNPEJPFNIP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)c2ccccc2)ccc1O |
| HS Code | 2914400090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-hydroxy-3-methyl-benzophenone |
| 3-Methyl-4-hydroxybenzophenone |
| hydroxy-4 methyl-3 benzophenone |
| 4-Hydroxy-3-methyl-benzophenon |