Acetamide,2-bromo-N-(2-nitrophenyl)- structure
|
Common Name | Acetamide,2-bromo-N-(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5326-94-3 | Molecular Weight | 259.05700 | |
| Density | 1.755g/cm3 | Boiling Point | 431.1ºC at 760mmHg | |
| Molecular Formula | C8H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 2-bromo-N-(2-nitrophenyl)acetamide |
|---|
| Density | 1.755g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760mmHg |
| Molecular Formula | C8H7BrN2O3 |
| Molecular Weight | 259.05700 |
| Flash Point | 214.5ºC |
| Exact Mass | 257.96400 |
| PSA | 74.92000 |
| LogP | 2.52440 |
| Index of Refraction | 1.665 |
| InChIKey | MDQWPKGGEFPESZ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)Nc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~94%
Acetamide,2-bro... CAS#:5326-94-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: WO2004/50643 A2, 2004 ; Location in patent: Page 43 ; WO 2004/050643 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |