2-(2-carboxylatoacetyl)benzoate structure
|
Common Name | 2-(2-carboxylatoacetyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 53266-48-1 | Molecular Weight | 206.15200 | |
| Density | N/A | Boiling Point | 484.4ºC at 760mmHg | |
| Molecular Formula | C10H6O5-- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.8ºC | |
| Name | 2-(2-carboxylatoacetyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 484.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H6O5-- |
| Molecular Weight | 206.15200 |
| Flash Point | 260.8ºC |
| Exact Mass | 206.02200 |
| PSA | 97.33000 |
| InChIKey | UFTYDYPGWHGYKH-UHFFFAOYSA-L |
| SMILES | O=C([O-])CC(=O)c1ccccc1C(=O)[O-] |
| HS Code | 2918300090 |
|---|
|
~%
2-(2-carboxylat... CAS#:53266-48-1
Detail
|
| Literature: Cunha-Filho, Marcilio S.S.; Estevez-Braun, Ana; Perez-Sacau, Elisa; Echezarreta-Lopez, Ma Magdalena; Martinez-Pacheco, Ramon; Landin, Mariana Journal of Pharmacy and Pharmacology, 2011 , vol. 63, # 9 p. 1156 - 1160 |
|
~%
2-(2-carboxylat... CAS#:53266-48-1 |
| Literature: Gabriel; Michael Chemische Berichte, 1877 , vol. 10, p. 1557 Chemische Berichte, 1878 , vol. 11, p. 1007 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| o-Carboxy-benzoylessigsaeure |
| 3-(2-Carboxy-phenyl)-3-oxo-propionsaeure |
| 2-(3-oxido-3-oxopropanoyl)benzoate |
| Benzenepropanoic acid,2-carboxy-b-oxo |
| Benzoicacid,o-carboxyacetyl-(6CI) |
| 2-Carboxy-benzoylessigsaeure |
| Benzoylessigsaeure-o-carbonsaeure |
| 2-(2-carboxyacetyl)benzoic acid |
| 3-(2-carboxy-phenyl)-3-oxo-propionic acid |