2,4-dichloro-1-(4-methylphenyl)sulfonyloxy-benzene structure
|
Common Name | 2,4-dichloro-1-(4-methylphenyl)sulfonyloxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 5328-03-0 | Molecular Weight | 317.18800 | |
| Density | 1.42g/cm3 | Boiling Point | 443.1ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8ºC | |
| Name | (2,4-dichlorophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760 mmHg |
| Molecular Formula | C13H10Cl2O3S |
| Molecular Weight | 317.18800 |
| Flash Point | 221.8ºC |
| Exact Mass | 315.97300 |
| PSA | 51.75000 |
| LogP | 5.15030 |
| Index of Refraction | 1.599 |
| InChIKey | JVULAOJMCZFRSC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2Cl)cc1 |
| HS Code | 2906299090 |
|---|
|
~%
2,4-dichloro-1-... CAS#:5328-03-0 |
| Literature: Groves; Turner; Sharp Journal of the Chemical Society, 1929 , p. 521 |
|
~%
2,4-dichloro-1-... CAS#:5328-03-0 |
| Literature: Groves; Turner; Sharp Journal of the Chemical Society, 1929 , p. 521 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Toluol-4-sulfonsaeure-(2,4-dichlor-phenylester) |
| NCI Code,4179 |
| 2,4-dichlorophenyl 4-methylbenzenesulfonate |
| toluene-4-sulfonic acid-(2,4-dichloro-phenyl ester) |
| 2,4-Dichlorphenoltosylat |