5-nitroisoindole-1,3-dione structure
|
Common Name | 5-nitroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5330-05-2 | Molecular Weight | 231.22700 | |
| Density | 1.609g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4KN2O4+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophthalimido)potassium |
|---|
| Density | 1.609g/cm3 |
|---|---|
| Molecular Formula | C8H4KN2O4+ |
| Molecular Weight | 231.22700 |
| Exact Mass | 230.98100 |
| PSA | 91.99000 |
| LogP | 1.33040 |
| Index of Refraction | 1.657 |
| InChIKey | PWEKMPDGTZDJDF-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2cc([N+](=O)[O-])ccc21.[K+] |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |