Phosphoric acid,5-(1,1-dimethylethyl)[1,1'-biphenyl]-2-yl bis[4-(1,1-dimethylethyl)phenyl]ester (9CI) structure
|
Common Name | Phosphoric acid,5-(1,1-dimethylethyl)[1,1'-biphenyl]-2-yl bis[4-(1,1-dimethylethyl)phenyl]ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5330-22-3 | Molecular Weight | 570.69800 | |
| Density | 1.09g/cm3 | Boiling Point | 604.9ºC at 760 mmHg | |
| Molecular Formula | C36H43O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.4ºC | |
| Name | bis(4-tert-butylphenyl) (4-tert-butyl-2-phenylphenyl) phosphate |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 604.9ºC at 760 mmHg |
| Molecular Formula | C36H43O4P |
| Molecular Weight | 570.69800 |
| Flash Point | 332.4ºC |
| Exact Mass | 570.29000 |
| PSA | 54.57000 |
| LogP | 10.89100 |
| Index of Refraction | 1.552 |
| InChIKey | AUQDJJSEYXLKOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(=O)(Oc2ccc(C(C)(C)C)cc2)Oc2ccc(C(C)(C)C)cc2-c2ccccc2)cc1 |
| HS Code | 2919900090 |
|---|
|
~%
Phosphoric acid... CAS#:5330-22-3 |
| Literature: Dow Chem Co. Patent: US2225285 , 1938 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |