1,3-Dioxolane,2,2-dimethyl-4-[(triphenylmethoxy)methyl]- structure
|
Common Name | 1,3-Dioxolane,2,2-dimethyl-4-[(triphenylmethoxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 5330-64-3 | Molecular Weight | 374.47200 | |
| Density | 1.098g/cm3 | Boiling Point | 473.8ºC at 760mmHg | |
| Molecular Formula | C25H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | 2,2-dimethyl-4-(trityloxymethyl)-1,3-dioxolane |
|---|
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 473.8ºC at 760mmHg |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.47200 |
| Flash Point | 162.3ºC |
| Exact Mass | 374.18800 |
| PSA | 27.69000 |
| LogP | 5.14660 |
| Index of Refraction | 1.56 |
| InChIKey | UMSIGAOAHUCMMZ-UHFFFAOYSA-N |
| SMILES | CC1(C)OCC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
|
~%
1,3-Dioxolane,2... CAS#:5330-64-3 |
| Literature: Hurd et al. Journal of the American Chemical Society, 1937 , vol. 59, p. 1952 |