Quinoline,4,7-dichloro-8-nitro structure
|
Common Name | Quinoline,4,7-dichloro-8-nitro | ||
|---|---|---|---|---|
| CAS Number | 5330-86-9 | Molecular Weight | 243.04600 | |
| Density | 1.593g/cm3 | Boiling Point | 372.4ºC at 760mmHg | |
| Molecular Formula | C9H4Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | 4,7-dichloro-8-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 372.4ºC at 760mmHg |
| Molecular Formula | C9H4Cl2N2O2 |
| Molecular Weight | 243.04600 |
| Flash Point | 179ºC |
| Exact Mass | 241.96500 |
| PSA | 58.71000 |
| LogP | 3.97300 |
| Index of Refraction | 1.693 |
| InChIKey | BVDZJEJLGLITID-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)ccc2c(Cl)ccnc12 |
| HS Code | 2933499090 |
|---|
|
~94%
Quinoline,4,7-d... CAS#:5330-86-9 |
| Literature: VIFOR (INTERNATIONAL) AG Patent: US2012/214803 A1, 2012 ; Location in patent: Page/Page column 130 ; US 20120214803 A1 |
|
~%
Quinoline,4,7-d... CAS#:5330-86-9 |
| Literature: Price et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 484,486 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-dichloro-8-nitro-quinoline |
| 4,7-Dichlor-8-nitro-chinolin |
| Quinoline,4,7-dichloro-8-nitro |